C15H27N3 — CID 105293942
3-(1-hydrazinylheptyl)-N,N-dimethylaniline (PubChem CID 105293942) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-(1-hydrazinylheptyl)-N,N-dimethylaniline.
| Compound Name | 3-(1-hydrazinylheptyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105293942 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-(1-hydrazinylheptyl)-N,N-dimethylaniline |
| SMILES | CCCCCCC(NN)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C15H27N3/c1-4-5-6-7-11-15(17-16)13-9-8-10-14(12-13)18(2)3/h8-10,12,15,17H,4-7,11,16H2,1-3H3 |
| InChIKey | NMCSYKBGHIOSAH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|