C12H21N3O — CID 105321186
3-(2-ethoxy-1-hydrazinylethyl)-N,N-dimethylaniline (PubChem CID 105321186) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(2-ethoxy-1-hydrazinylethyl)-N,N-dimethylaniline.
| Compound Name | 3-(2-ethoxy-1-hydrazinylethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105321186 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-(2-ethoxy-1-hydrazinylethyl)-N,N-dimethylaniline |
| SMILES | CCOCC(NN)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C12H21N3O/c1-4-16-9-12(14-13)10-6-5-7-11(8-10)15(2)3/h5-8,12,14H,4,9,13H2,1-3H3 |
| InChIKey | VHKGFOMBUILOCE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|