C16H19BrClN3 — CID 105335162
3-[2-(4-bromo-2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylaniline (PubChem CID 105335162) has the molecular formula C16H19BrClN3 and a molecular weight of 368.71 g/mol. Its IUPAC name is 3-[2-(4-bromo-2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylaniline.
| Compound Name | 3-[2-(4-bromo-2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105335162 |
| Molecular Formula | C16H19BrClN3 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 3-[2-(4-bromo-2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(Cc2ccc(Br)cc2Cl)NN)c1 |
| InChI | InChI=1S/C16H19BrClN3/c1-21(2)14-5-3-4-12(8-14)16(20-19)9-11-6-7-13(17)10-15(11)18/h3-8,10,16,20H,9,19H2,1-2H3 |
| InChIKey | GOPBARZCQVGZKN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|