C17H18BrClN2 — CID 105335217
[2-(4-bromo-2-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine (PubChem CID 105335217) has the molecular formula C17H18BrClN2 and a molecular weight of 365.70 g/mol. Its IUPAC name is [2-(4-bromo-2-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-2-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105335217 |
| Molecular Formula | C17H18BrClN2 |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [2-(4-bromo-2-chlorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cc1Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18BrClN2/c18-15-7-6-13(16(19)10-15)9-17(21-20)14-5-4-11-2-1-3-12(11)8-14/h4-8,10,17,21H,1-3,9,20H2 |
| InChIKey | RFFYAVNGUJHJFO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|