C17H18BrFN2 — CID 105294931
[2-(5-bromo-2-fluorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine (PubChem CID 105294931) has the molecular formula C17H18BrFN2 and a molecular weight of 349.25 g/mol. Its IUPAC name is [2-(5-bromo-2-fluorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2-fluorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105294931 |
| Molecular Formula | C17H18BrFN2 |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [2-(5-bromo-2-fluorophenyl)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(Br)ccc1F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18BrFN2/c18-15-6-7-16(19)14(9-15)10-17(21-20)13-5-4-11-2-1-3-12(11)8-13/h4-9,17,21H,1-3,10,20H2 |
| InChIKey | YKMZUOKFRHFDPS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|