C13H17ClN4O — CID 105127736
(4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-6-methylpyridazin-4-yl)methanol (PubChem CID 105127736) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-6-methylpyridazin-4-yl)methanol.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-6-methylpyridazin-4-yl)methanol |
|---|---|
| PubChem CID | 105127736 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-6-methylpyridazin-4-yl)methanol |
| SMILES | CCc1nnc(C)cc1C(O)c1c(Cl)cnn1CC |
| InChI | InChI=1S/C13H17ClN4O/c1-4-11-9(6-8(3)16-17-11)13(19)12-10(14)7-15-18(12)5-2/h6-7,13,19H,4-5H2,1-3H3 |
| InChIKey | YERUFISLIGOXAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |