C12H20BrN3OS — CID 105127935
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(thiolan-3-yl)methanol (PubChem CID 105127935) has the molecular formula C12H20BrN3OS and a molecular weight of 334.28 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(thiolan-3-yl)methanol.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 105127935 |
| Molecular Formula | C12H20BrN3OS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(thiolan-3-yl)methanol |
| SMILES | CN(C)CCn1ncc(Br)c1C(O)C1CCSC1 |
| InChI | InChI=1S/C12H20BrN3OS/c1-15(2)4-5-16-11(10(13)7-14-16)12(17)9-3-6-18-8-9/h7,9,12,17H,3-6,8H2,1-2H3 |
| InChIKey | PHSHZTAZKGQCGQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |