C13H22BrN3O2 — CID 115834962
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-methyloxolan-3-yl)methanol (PubChem CID 115834962) has the molecular formula C13H22BrN3O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-methyloxolan-3-yl)methanol.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-methyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 115834962 |
| Molecular Formula | C13H22BrN3O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-methyloxolan-3-yl)methanol |
| SMILES | CC1CC(C(O)c2c(Br)cnn2CCN(C)C)CO1 |
| InChI | InChI=1S/C13H22BrN3O2/c1-9-6-10(8-19-9)13(18)12-11(14)7-15-17(12)5-4-16(2)3/h7,9-10,13,18H,4-6,8H2,1-3H3 |
| InChIKey | BZWPKWOISRBIQZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |