C15H14BrFN2OS — CID 105128052
(4-bromo-1-propylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol (PubChem CID 105128052) has the molecular formula C15H14BrFN2OS and a molecular weight of 369.26 g/mol. Its IUPAC name is (4-bromo-1-propylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol.
| Compound Name | (4-bromo-1-propylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 105128052 |
| Molecular Formula | C15H14BrFN2OS |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | (4-bromo-1-propylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol |
| SMILES | CCCn1ncc(Br)c1C(O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H14BrFN2OS/c1-2-5-19-14(11(16)8-18-19)15(20)13-7-9-6-10(17)3-4-12(9)21-13/h3-4,6-8,15,20H,2,5H2,1H3 |
| InChIKey | QWHBYFQUPKYMPH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |