C15H14ClFN2OS — CID 105128234
(4-chloro-1-propan-2-ylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol (PubChem CID 105128234) has the molecular formula C15H14ClFN2OS and a molecular weight of 324.81 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol.
| Compound Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 105128234 |
| Molecular Formula | C15H14ClFN2OS |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(5-fluoro-1-benzothiophen-2-yl)methanol |
| SMILES | CC(C)n1ncc(Cl)c1C(O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H14ClFN2OS/c1-8(2)19-14(11(16)7-18-19)15(20)13-6-9-5-10(17)3-4-12(9)21-13/h3-8,15,20H,1-2H3 |
| InChIKey | FACJRNUDVWDWRI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |