C11H13BrN4O2 — CID 105131081
[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 105131081) has the molecular formula C11H13BrN4O2 and a molecular weight of 313.16 g/mol. Its IUPAC name is [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 105131081 |
| Molecular Formula | C11H13BrN4O2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | COCCn1ncc(Br)c1C(=O)c1ccnn1C |
| InChI | InChI=1S/C11H13BrN4O2/c1-15-9(3-4-13-15)11(17)10-8(12)7-14-16(10)5-6-18-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ZJCFWYYLGHXKFT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |