C13H11Br2FN2O2 — CID 114905769
(4-bromo-2-fluorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanone (PubChem CID 114905769) has the molecular formula C13H11Br2FN2O2 and a molecular weight of 406.05 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanone.
| Compound Name | (4-bromo-2-fluorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 114905769 |
| Molecular Formula | C13H11Br2FN2O2 |
| Molecular Weight | 406.05 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
| SMILES | COCCn1ncc(Br)c1C(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H11Br2FN2O2/c1-20-5-4-18-12(10(15)7-17-18)13(19)9-3-2-8(14)6-11(9)16/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | WVQAPPDDIVIGKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |