C13H10BrClF2N2O2 — CID 107537998
(2-bromo-3,4-difluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone (PubChem CID 107537998) has the molecular formula C13H10BrClF2N2O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone.
| Compound Name | (2-bromo-3,4-difluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 107537998 |
| Molecular Formula | C13H10BrClF2N2O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C13H10BrClF2N2O2/c1-21-5-4-19-12(8(15)6-18-19)13(20)7-2-3-9(16)11(17)10(7)14/h2-3,6H,4-5H2,1H3 |
| InChIKey | FUERJPIMTPJVFF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|