C14H14BrClN2O3 — CID 105135470
(2-bromo-5-methoxyphenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone (PubChem CID 105135470) has the molecular formula C14H14BrClN2O3 and a molecular weight of 373.63 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 105135470 |
| Molecular Formula | C14H14BrClN2O3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C14H14BrClN2O3/c1-20-6-5-18-13(12(16)8-17-18)14(19)10-7-9(21-2)3-4-11(10)15/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | JOTNHRTZKXFEAS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |