C14H14Cl2N2O2 — CID 115815253
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-chloro-3-methylphenyl)methanone (PubChem CID 115815253) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-chloro-3-methylphenyl)methanone.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-chloro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 115815253 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-chloro-3-methylphenyl)methanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9-7-10(3-4-11(9)15)14(19)13-12(16)8-17-18(13)5-6-20-2/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | TYCIZBPBJGPWJO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |