C13H11BrClFN2O2 — CID 107957438
(3-bromo-2-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone (PubChem CID 107957438) has the molecular formula C13H11BrClFN2O2 and a molecular weight of 361.60 g/mol. Its IUPAC name is (3-bromo-2-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone.
| Compound Name | (3-bromo-2-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 107957438 |
| Molecular Formula | C13H11BrClFN2O2 |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | (3-bromo-2-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C13H11BrClFN2O2/c1-20-6-5-18-12(10(15)7-17-18)13(19)8-3-2-4-9(14)11(8)16/h2-4,7H,5-6H2,1H3 |
| InChIKey | UFECUKVAFBYDAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |