C14H14BrCl2N3O — CID 115802753
(3-bromo-2-chlorophenyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone (PubChem CID 115802753) has the molecular formula C14H14BrCl2N3O and a molecular weight of 391.10 g/mol. Its IUPAC name is (3-bromo-2-chlorophenyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone.
| Compound Name | (3-bromo-2-chlorophenyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 115802753 |
| Molecular Formula | C14H14BrCl2N3O |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | (3-bromo-2-chlorophenyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C14H14BrCl2N3O/c1-19(2)6-7-20-13(11(16)8-18-20)14(21)9-4-3-5-10(15)12(9)17/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | XPWVXXNYZWDAIB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |