C15H17BrClN3O — CID 115804288
[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-3-methylphenyl)methanone (PubChem CID 115804288) has the molecular formula C15H17BrClN3O and a molecular weight of 370.68 g/mol. Its IUPAC name is [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-3-methylphenyl)methanone.
| Compound Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 115804288 |
| Molecular Formula | C15H17BrClN3O |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | [4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(2-chloro-3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)c2c(Br)cnn2CCN(C)C)c1Cl |
| InChI | InChI=1S/C15H17BrClN3O/c1-10-5-4-6-11(13(10)17)15(21)14-12(16)9-18-20(14)8-7-19(2)3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | WYPFKGZTQGDYMP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |