C12H14ClN5O — CID 102923235
[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-pyrimidin-5-ylmethanone (PubChem CID 102923235) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 102923235 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-pyrimidin-5-ylmethanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)c1cncnc1 |
| InChI | InChI=1S/C12H14ClN5O/c1-17(2)3-4-18-11(10(13)7-16-18)12(19)9-5-14-8-15-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | WXUQMAQXFGWHAQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |