C13H14ClFN4O — CID 114641499
[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-fluoro-2-pyridinyl)methanone (PubChem CID 114641499) has the molecular formula C13H14ClFN4O and a molecular weight of 296.73 g/mol. Its IUPAC name is [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 114641499 |
| Molecular Formula | C13H14ClFN4O |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(5-fluoro-2-pyridinyl)methanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H14ClFN4O/c1-18(2)5-6-19-12(10(14)8-17-19)13(20)11-4-3-9(15)7-16-11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | KWGUUBZKBRSUQE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |