C15H17ClFN3O — CID 114639082
1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 114639082) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 114639082 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H17ClFN3O/c1-19(2)7-8-20-15(13(16)10-18-20)14(21)9-11-3-5-12(17)6-4-11/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | YZBYWUCADPFUFJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |