C14H15ClIN3O — CID 115802696
[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(4-iodophenyl)methanone (PubChem CID 115802696) has the molecular formula C14H15ClIN3O and a molecular weight of 403.65 g/mol. Its IUPAC name is [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(4-iodophenyl)methanone.
| Compound Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 115802696 |
| Molecular Formula | C14H15ClIN3O |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | [4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-(4-iodophenyl)methanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H15ClIN3O/c1-18(2)7-8-19-13(12(15)9-17-19)14(20)10-3-5-11(16)6-4-10/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | PACKEPMXVYDUDH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|