C15H14FNOS — CID 105134166
1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-thiophen-2-ylethanamine (PubChem CID 105134166) has the molecular formula C15H14FNOS and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-thiophen-2-ylethanamine.
| Compound Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 105134166 |
| Molecular Formula | C15H14FNOS |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-thiophen-2-ylethanamine |
| SMILES | Cc1c(C(N)Cc2cccs2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C15H14FNOS/c1-9-12-7-10(16)4-5-14(12)18-15(9)13(17)8-11-3-2-6-19-11/h2-7,13H,8,17H2,1H3 |
| InChIKey | KNDMSVZCNCXIKQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |