C16H25BrFNO — CID 105136340
1-(2-bromo-4-fluorophenyl)-4-propoxy-N-propylbutan-2-amine (PubChem CID 105136340) has the molecular formula C16H25BrFNO and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-4-propoxy-N-propylbutan-2-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-4-propoxy-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 105136340 |
| Molecular Formula | C16H25BrFNO |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-4-propoxy-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOCCC)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C16H25BrFNO/c1-3-8-19-15(7-10-20-9-4-2)11-13-5-6-14(18)12-16(13)17/h5-6,12,15,19H,3-4,7-11H2,1-2H3 |
| InChIKey | WCQVPALCDBJJCM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|