C15H23BrFNO — CID 105136270
1-(2-bromo-4-fluorophenyl)-4-ethoxy-N-propylbutan-2-amine (PubChem CID 105136270) has the molecular formula C15H23BrFNO and a molecular weight of 332.26 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-4-ethoxy-N-propylbutan-2-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-4-ethoxy-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 105136270 |
| Molecular Formula | C15H23BrFNO |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-4-ethoxy-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOCC)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H23BrFNO/c1-3-8-18-14(7-9-19-4-2)10-12-5-6-13(17)11-15(12)16/h5-6,11,14,18H,3-4,7-10H2,1-2H3 |
| InChIKey | NFPNCGHNZCCPIF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|