C16H23N3 — CID 105140273
(1,3-diethylpyrazol-5-yl)-(3,4-dimethylphenyl)methanamine (PubChem CID 105140273) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)-(3,4-dimethylphenyl)methanamine.
| Compound Name | (1,3-diethylpyrazol-5-yl)-(3,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 105140273 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (1,3-diethylpyrazol-5-yl)-(3,4-dimethylphenyl)methanamine |
| SMILES | CCc1cc(C(N)c2ccc(C)c(C)c2)n(CC)n1 |
| InChI | InChI=1S/C16H23N3/c1-5-14-10-15(19(6-2)18-14)16(17)13-8-7-11(3)12(4)9-13/h7-10,16H,5-6,17H2,1-4H3 |
| InChIKey | KCVXDUQVGOFNRS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |