C14H14F2N2 — CID 105142017
(3,5-difluorophenyl)-(2,6-dimethyl-3-pyridinyl)methanamine (PubChem CID 105142017) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2,6-dimethyl-3-pyridinyl)methanamine.
| Compound Name | (3,5-difluorophenyl)-(2,6-dimethyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 105142017 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (3,5-difluorophenyl)-(2,6-dimethyl-3-pyridinyl)methanamine |
| SMILES | Cc1ccc(C(N)c2cc(F)cc(F)c2)c(C)n1 |
| InChI | InChI=1S/C14H14F2N2/c1-8-3-4-13(9(2)18-8)14(17)10-5-11(15)7-12(16)6-10/h3-7,14H,17H2,1-2H3 |
| InChIKey | ZHYOVFKSHMKZBO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |