C13H15Cl2F2N — CID 105142294
(2,5-dichlorophenyl)-(4,4-difluorocyclohexyl)methanamine (PubChem CID 105142294) has the molecular formula C13H15Cl2F2N and a molecular weight of 294.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(4,4-difluorocyclohexyl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(4,4-difluorocyclohexyl)methanamine |
|---|---|
| PubChem CID | 105142294 |
| Molecular Formula | C13H15Cl2F2N |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (2,5-dichlorophenyl)-(4,4-difluorocyclohexyl)methanamine |
| SMILES | NC(c1cc(Cl)ccc1Cl)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H15Cl2F2N/c14-9-1-2-11(15)10(7-9)12(18)8-3-5-13(16,17)6-4-8/h1-2,7-8,12H,3-6,18H2 |
| InChIKey | QEEWZHMWTSSIQN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |