C16H23Cl2N — CID 65423953
(2,5-dichlorophenyl)-(4-propylcyclohexyl)methanamine (PubChem CID 65423953) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(4-propylcyclohexyl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(4-propylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 65423953 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2,5-dichlorophenyl)-(4-propylcyclohexyl)methanamine |
| SMILES | CCCC1CCC(C(N)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H23Cl2N/c1-2-3-11-4-6-12(7-5-11)16(19)14-10-13(17)8-9-15(14)18/h8-12,16H,2-7,19H2,1H3 |
| InChIKey | HXDYHBKSLYESFQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |