C13H22O4 — CID 10514305
(3E,4R,5S)-3-hexylidene-4-(methoxymethoxy)-5-methyloxolan-2-one (PubChem CID 10514305) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3E,4R,5S)-3-hexylidene-4-(methoxymethoxy)-5-methyloxolan-2-one.
| Compound Name | (3E,4R,5S)-3-hexylidene-4-(methoxymethoxy)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 10514305 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3E,4R,5S)-3-hexylidene-4-(methoxymethoxy)-5-methyloxolan-2-one |
| SMILES | CCCCC/C=C1/C(=O)O[C@@H](C)[C@@H]1OCOC |
| InChI | InChI=1S/C13H22O4/c1-4-5-6-7-8-11-12(16-9-15-3)10(2)17-13(11)14/h8,10,12H,4-7,9H2,1-3H3/b11-8+/t10-,12-/m0/s1 |
| InChIKey | SQMSGJFKCGDHKP-MEPBBVLVSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|