C19H27NS — CID 105145207
1-(2,4-dimethylphenyl)-N-propyl-4-thiophen-2-ylbutan-1-amine (PubChem CID 105145207) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-propyl-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-N-propyl-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 105145207 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-propyl-4-thiophen-2-ylbutan-1-amine |
| SMILES | CCCNC(CCCc1cccs1)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H27NS/c1-4-12-20-19(9-5-7-17-8-6-13-21-17)18-11-10-15(2)14-16(18)3/h6,8,10-11,13-14,19-20H,4-5,7,9,12H2,1-3H3 |
| InChIKey | JMZDZUQWHASOKZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |