C13H23LiO2Si — CID 10514595
lithium tert-butyl-[(2R,3S)-2-ethynyloxan-3-yl]oxy-dimethylsilane (PubChem CID 10514595) has the molecular formula C13H23LiO2Si and a molecular weight of 246.35 g/mol. Its IUPAC name is lithium tert-butyl-[(2R,3S)-2-ethynyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | lithium tert-butyl-[(2R,3S)-2-ethynyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10514595 |
| Molecular Formula | C13H23LiO2Si |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | lithium tert-butyl-[(2R,3S)-2-ethynyloxan-3-yl]oxy-dimethylsilane |
| SMILES | [C-]#C[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C13H23O2Si.Li/c1-7-11-12(9-8-10-14-11)15-16(5,6)13(2,3)4;/h11-12H,8-10H2,2-6H3;/q-1;+1/t11-,12+;/m1./s1 |
| InChIKey | SGIOZTXGXLRMPU-LYCTWNKOSA-N |
| XLogP | 0.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|