C12H16F3NO — CID 105146480
3-ethoxy-N-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine (PubChem CID 105146480) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-ethoxy-N-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine.
| Compound Name | 3-ethoxy-N-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 105146480 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-ethoxy-N-methyl-1-(2,3,4-trifluorophenyl)propan-1-amine |
| SMILES | CCOCCC(NC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H16F3NO/c1-3-17-7-6-10(16-2)8-4-5-9(13)12(15)11(8)14/h4-5,10,16H,3,6-7H2,1-2H3 |
| InChIKey | XAJJCPLMPVLMPC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|