C15H9BrF3NO — CID 105146562
(7-bromo-1-benzofuran-2-yl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 105146562) has the molecular formula C15H9BrF3NO and a molecular weight of 356.14 g/mol. Its IUPAC name is (7-bromo-1-benzofuran-2-yl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (7-bromo-1-benzofuran-2-yl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105146562 |
| Molecular Formula | C15H9BrF3NO |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (7-bromo-1-benzofuran-2-yl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1cc2cccc(Br)c2o1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9BrF3NO/c16-9-3-1-2-7-6-11(21-15(7)9)14(20)8-4-5-10(17)13(19)12(8)18/h1-6,14H,20H2 |
| InChIKey | GXFOQIKSELKHOW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|