C15H8Br2F2O2 — CID 106945078
(7-bromo-1-benzofuran-2-yl)-(3-bromo-2,6-difluorophenyl)methanol (PubChem CID 106945078) has the molecular formula C15H8Br2F2O2 and a molecular weight of 418.03 g/mol. Its IUPAC name is (7-bromo-1-benzofuran-2-yl)-(3-bromo-2,6-difluorophenyl)methanol.
| Compound Name | (7-bromo-1-benzofuran-2-yl)-(3-bromo-2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 106945078 |
| Molecular Formula | C15H8Br2F2O2 |
| Molecular Weight | 418.03 g/mol |
| Exact Mass | 415.89 |
| IUPAC Name | (7-bromo-1-benzofuran-2-yl)-(3-bromo-2,6-difluorophenyl)methanol |
| SMILES | OC(c1cc2cccc(Br)c2o1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H8Br2F2O2/c16-8-4-5-10(18)12(13(8)19)14(20)11-6-7-2-1-3-9(17)15(7)21-11/h1-6,14,20H |
| InChIKey | GFCMZQFAAJBKHP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.03 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|