C10H17NOS — CID 105146707
N-ethyl-1-(furan-3-yl)-3-methylsulfanylpropan-1-amine (PubChem CID 105146707) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is N-ethyl-1-(furan-3-yl)-3-methylsulfanylpropan-1-amine.
| Compound Name | N-ethyl-1-(furan-3-yl)-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 105146707 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-ethyl-1-(furan-3-yl)-3-methylsulfanylpropan-1-amine |
| SMILES | CCNC(CCSC)c1ccoc1 |
| InChI | InChI=1S/C10H17NOS/c1-3-11-10(5-7-13-2)9-4-6-12-8-9/h4,6,8,10-11H,3,5,7H2,1-2H3 |
| InChIKey | DWSJYKWBWGRDJX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |