C9H11N3OS — CID 105146743
N-[furan-3-yl(1,2,5-thiadiazol-3-yl)methyl]ethanamine (PubChem CID 105146743) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N-[furan-3-yl(1,2,5-thiadiazol-3-yl)methyl]ethanamine.
| Compound Name | N-[furan-3-yl(1,2,5-thiadiazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105146743 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-[furan-3-yl(1,2,5-thiadiazol-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccoc1)c1cnsn1 |
| InChI | InChI=1S/C9H11N3OS/c1-2-10-9(7-3-4-13-6-7)8-5-11-14-12-8/h3-6,9-10H,2H2,1H3 |
| InChIKey | BZRWVFGMTLEJIL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |