C9H12N4O — CID 65360300
N-[furan-3-yl(1H-1,2,4-triazol-5-yl)methyl]ethanamine (PubChem CID 65360300) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[furan-3-yl(1H-1,2,4-triazol-5-yl)methyl]ethanamine.
| Compound Name | N-[furan-3-yl(1H-1,2,4-triazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 65360300 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-[furan-3-yl(1H-1,2,4-triazol-5-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccoc1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4O/c1-2-10-8(7-3-4-14-5-7)9-11-6-12-13-9/h3-6,8,10H,2H2,1H3,(H,11,12,13) |
| InChIKey | JEFITYHXZNALNL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |