C13H12F3NO — CID 103302725
N-[furan-3-yl-(2,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 103302725) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is N-[furan-3-yl-(2,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[furan-3-yl-(2,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103302725 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[furan-3-yl-(2,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccoc1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H12F3NO/c1-2-17-13(8-3-4-18-7-8)9-5-11(15)12(16)6-10(9)14/h3-7,13,17H,2H2,1H3 |
| InChIKey | KHAWWMGYINPMPD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|