C14H19NO3 — CID 10514754
[6-cyano-1-(2,3-dimethyloxiran-2-yl)-3-methylhex-1-yn-3-yl] acetate (PubChem CID 10514754) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is [6-cyano-1-(2,3-dimethyloxiran-2-yl)-3-methylhex-1-yn-3-yl] acetate.
| Compound Name | [6-cyano-1-(2,3-dimethyloxiran-2-yl)-3-methylhex-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 10514754 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [6-cyano-1-(2,3-dimethyloxiran-2-yl)-3-methylhex-1-yn-3-yl] acetate |
| SMILES | CC(=O)OC(C)(C#CC1(C)OC1C)CCCC#N |
| InChI | InChI=1S/C14H19NO3/c1-11-14(4,17-11)9-8-13(3,18-12(2)16)7-5-6-10-15/h11H,5-7H2,1-4H3 |
| InChIKey | GOSQIZSJUQDGIH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|