C13H22O2 — CID 131744189
3,7-dimethylnon-1-yn-3-yl acetate (PubChem CID 131744189) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3,7-dimethylnon-1-yn-3-yl acetate.
| Compound Name | 3,7-dimethylnon-1-yn-3-yl acetate |
|---|---|
| PubChem CID | 131744189 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3,7-dimethylnon-1-yn-3-yl acetate |
| SMILES | C#CC(C)(CCCC(C)CC)OC(C)=O |
| InChI | InChI=1S/C13H22O2/c1-6-11(3)9-8-10-13(5,7-2)15-12(4)14/h2,11H,6,8-10H2,1,3-5H3 |
| InChIKey | KJWIJYDMNIPWNT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|