C11H19F2NO — CID 105147656
(4,4-difluorocyclohexyl)-(oxolan-3-yl)methanamine (PubChem CID 105147656) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(oxolan-3-yl)methanamine.
| Compound Name | (4,4-difluorocyclohexyl)-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105147656 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(oxolan-3-yl)methanamine |
| SMILES | NC(C1CCC(F)(F)CC1)C1CCOC1 |
| InChI | InChI=1S/C11H19F2NO/c12-11(13)4-1-8(2-5-11)10(14)9-3-6-15-7-9/h8-10H,1-7,14H2 |
| InChIKey | GRJMCPKBIUUZJY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |