C14H16ClNOS — CID 105147757
1-(4-chlorophenoxy)-4-thiophen-3-ylbutan-2-amine (PubChem CID 105147757) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-4-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(4-chlorophenoxy)-4-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 105147757 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-(4-chlorophenoxy)-4-thiophen-3-ylbutan-2-amine |
| SMILES | NC(CCc1ccsc1)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNOS/c15-12-2-5-14(6-3-12)17-9-13(16)4-1-11-7-8-18-10-11/h2-3,5-8,10,13H,1,4,9,16H2 |
| InChIKey | SFBROVGAZLRLBG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |