C15H22N4O — CID 105148511
N-[(2-ethylpyrazol-3-yl)-(2-methoxy-3-pyridinyl)methyl]propan-1-amine (PubChem CID 105148511) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)-(2-methoxy-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(2-ethylpyrazol-3-yl)-(2-methoxy-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105148511 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)-(2-methoxy-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccnc1OC)c1ccnn1CC |
| InChI | InChI=1S/C15H22N4O/c1-4-9-16-14(13-8-11-18-19(13)5-2)12-7-6-10-17-15(12)20-3/h6-8,10-11,14,16H,4-5,9H2,1-3H3 |
| InChIKey | AGMKBDSQLQPFLP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |