C15H20IN3 — CID 115858269
N-[(2-ethylpyrazol-3-yl)-(4-iodophenyl)methyl]propan-1-amine (PubChem CID 115858269) has the molecular formula C15H20IN3 and a molecular weight of 369.25 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)-(4-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[(2-ethylpyrazol-3-yl)-(4-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115858269 |
| Molecular Formula | C15H20IN3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)-(4-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)cc1)c1ccnn1CC |
| InChI | InChI=1S/C15H20IN3/c1-3-10-17-15(12-5-7-13(16)8-6-12)14-9-11-18-19(14)4-2/h5-9,11,15,17H,3-4,10H2,1-2H3 |
| InChIKey | TZTCELHKGFRZQS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|