C9H13N3S — CID 105150077
pyrazin-2-yl(thiolan-3-yl)methanamine (PubChem CID 105150077) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is pyrazin-2-yl(thiolan-3-yl)methanamine.
| Compound Name | pyrazin-2-yl(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105150077 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | pyrazin-2-yl(thiolan-3-yl)methanamine |
| SMILES | NC(c1cnccn1)C1CCSC1 |
| InChI | InChI=1S/C9H13N3S/c10-9(7-1-4-13-6-7)8-5-11-2-3-12-8/h2-3,5,7,9H,1,4,6,10H2 |
| InChIKey | OOTIQTUOCJYPLQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |