About 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline
3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 105150495) has the molecular formula C13H15BrN2O
and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline |
| PubChem CID | 105150495 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(N)c2occc2Br)c1 |
| InChI | InChI=1S/C13H15BrN2O/c1-16(2)10-5-3-4-9(8-10)12(15)13-11(14)6-7-17-13/h3-8,12H,15H2,1-2H3 |
| InChIKey | KOPIQMJZDINPII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline?
The IUPAC name of 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline (CID 105150495) is 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline.
What is the SMILES notation for 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline?
The canonical SMILES for 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline is CN(C)c1cccc(C(N)c2occc2Br)c1.
What is the InChIKey of 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline?
The InChIKey is KOPIQMJZDINPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O/c1-16(2)10-5-3-4-9(8-10)12(15)13-11(14)6-7-17-13/h3-8,12H,15H2,1-2H3.
What are the key properties of 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline?
3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline has a molecular weight of 295.18 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline is sourced from PubChem (CID 105150495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).