C13H15BrN2O — CID 105150495
3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 105150495) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105150495 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[amino-(3-bromofuran-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(N)c2occc2Br)c1 |
| InChI | InChI=1S/C13H15BrN2O/c1-16(2)10-5-3-4-9(8-10)12(15)13-11(14)6-7-17-13/h3-8,12H,15H2,1-2H3 |
| InChIKey | KOPIQMJZDINPII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |