C16H13F2N3 — CID 105150847
(2,3-difluorophenyl)-(1-phenylpyrazol-3-yl)methanamine (PubChem CID 105150847) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1-phenylpyrazol-3-yl)methanamine.
| Compound Name | (2,3-difluorophenyl)-(1-phenylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 105150847 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2,3-difluorophenyl)-(1-phenylpyrazol-3-yl)methanamine |
| SMILES | NC(c1ccn(-c2ccccc2)n1)c1cccc(F)c1F |
| InChI | InChI=1S/C16H13F2N3/c17-13-8-4-7-12(15(13)18)16(19)14-9-10-21(20-14)11-5-2-1-3-6-11/h1-10,16H,19H2 |
| InChIKey | DOLBMEKOXIBQPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |