C16H27NS — CID 105151151
N-ethyl-1-(2-ethylcyclohexyl)-2-thiophen-3-ylethanamine (PubChem CID 105151151) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is N-ethyl-1-(2-ethylcyclohexyl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(2-ethylcyclohexyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 105151151 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-ethyl-1-(2-ethylcyclohexyl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)C1CCCCC1CC |
| InChI | InChI=1S/C16H27NS/c1-3-14-7-5-6-8-15(14)16(17-4-2)11-13-9-10-18-12-13/h9-10,12,14-17H,3-8,11H2,1-2H3 |
| InChIKey | JPZRHUHJVQGNOO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |