C14H23NS2 — CID 80626191
N-[1-(thian-2-yl)-2-thiophen-3-ylethyl]propan-1-amine (PubChem CID 80626191) has the molecular formula C14H23NS2 and a molecular weight of 269.48 g/mol. Its IUPAC name is N-[1-(thian-2-yl)-2-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[1-(thian-2-yl)-2-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 80626191 |
| Molecular Formula | C14H23NS2 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[1-(thian-2-yl)-2-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccsc1)C1CCCCS1 |
| InChI | InChI=1S/C14H23NS2/c1-2-7-15-13(10-12-6-9-16-11-12)14-5-3-4-8-17-14/h6,9,11,13-15H,2-5,7-8,10H2,1H3 |
| InChIKey | FNHKIBFOSSLSCS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |